About 9-(2,3-dihydroxypropyl)-3H-purine-6-thione
9-(2,3-dihydroxypropyl)-3H-purine-6-thione (PubChem CID 15957683) has the molecular formula C8H10N4O2S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 9-(2,3-dihydroxypropyl)-3H-purine-6-thione.
Molecular Properties
| Compound Name | 9-(2,3-dihydroxypropyl)-3H-purine-6-thione |
| PubChem CID | 15957683 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 9-(2,3-dihydroxypropyl)-3H-purine-6-thione |
| SMILES | OCC(O)Cn1cnc2c(=S)nc[nH]c21 |
| InChI | InChI=1S/C8H10N4O2S/c13-2-5(14)1-12-4-11-6-7(12)9-3-10-8(6)15/h3-5,13-14H,1-2H2,(H,9,10,15) |
| InChIKey | HEUWTPNMBAYIJW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-(2,3-dihydroxypropyl)-3H-purine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,3-dihydroxypropyl)-3H-purine-6-thione?
The IUPAC name of 9-(2,3-dihydroxypropyl)-3H-purine-6-thione (CID 15957683) is 9-(2,3-dihydroxypropyl)-3H-purine-6-thione.
What is the SMILES notation for 9-(2,3-dihydroxypropyl)-3H-purine-6-thione?
The canonical SMILES for 9-(2,3-dihydroxypropyl)-3H-purine-6-thione is OCC(O)Cn1cnc2c(=S)nc[nH]c21.
What is the InChIKey of 9-(2,3-dihydroxypropyl)-3H-purine-6-thione?
The InChIKey is HEUWTPNMBAYIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S/c13-2-5(14)1-12-4-11-6-7(12)9-3-10-8(6)15/h3-5,13-14H,1-2H2,(H,9,10,15).
What are the key properties of 9-(2,3-dihydroxypropyl)-3H-purine-6-thione?
9-(2,3-dihydroxypropyl)-3H-purine-6-thione has a molecular weight of 226.26 g/mol, XLogP of -0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,3-dihydroxypropyl)-3H-purine-6-thione is sourced from PubChem (CID 15957683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).