About 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol
3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol (PubChem CID 15957685) has the molecular formula C8H13N5O2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol |
| PubChem CID | 15957685 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol |
| SMILES | NC1=NCN(CC(O)CO)c2nc[nH]c21 |
| InChI | InChI=1S/C8H13N5O2/c9-7-6-8(11-3-10-6)13(4-12-7)1-5(15)2-14/h3,5,14-15H,1-2,4H2,(H2,9,12)(H,10,11) |
| InChIKey | FEGVNQPQZBMTFJ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol?
The IUPAC name of 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol (CID 15957685) is 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol.
What is the SMILES notation for 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol?
The canonical SMILES for 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol is NC1=NCN(CC(O)CO)c2nc[nH]c21.
What is the InChIKey of 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol?
The InChIKey is FEGVNQPQZBMTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2/c9-7-6-8(11-3-10-6)13(4-12-7)1-5(15)2-14/h3,5,14-15H,1-2,4H2,(H2,9,12)(H,10,11).
What are the key properties of 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol?
3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol has a molecular weight of 211.22 g/mol, XLogP of -1.75, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-amino-2,7-dihydropurin-3-yl)propane-1,2-diol is sourced from PubChem (CID 15957685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).