C15H20ClN3O2S — CID 159576941
6-chloro-4-[(3S,5R)-3,5-dimethyl-4-methylsulfonylpiperazin-1-yl]-1H-indole (PubChem CID 159576941) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is 6-chloro-4-[(3S,5R)-3,5-dimethyl-4-methylsulfonylpiperazin-1-yl]-1H-indole.
| Compound Name | 6-chloro-4-[(3S,5R)-3,5-dimethyl-4-methylsulfonylpiperazin-1-yl]-1H-indole |
|---|---|
| PubChem CID | 159576941 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 6-chloro-4-[(3S,5R)-3,5-dimethyl-4-methylsulfonylpiperazin-1-yl]-1H-indole |
| SMILES | C[C@@H]1CN(c2cc(Cl)cc3[nH]ccc23)C[C@H](C)N1S(C)(=O)=O |
| InChI | InChI=1S/C15H20ClN3O2S/c1-10-8-18(9-11(2)19(10)22(3,20)21)15-7-12(16)6-14-13(15)4-5-17-14/h4-7,10-11,17H,8-9H2,1-3H3/t10-,11+ |
| InChIKey | ZOYIQUXSFVVCSL-PHIMTYICSA-N |
| XLogP | 2.68 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |