C18H26ClN3O4 — CID 159577215
(E)-but-2-enedioic acid;5-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridin-2-amine (PubChem CID 159577215) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridin-2-amine.
| Compound Name | (E)-but-2-enedioic acid;5-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 159577215 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (E)-but-2-enedioic acid;5-chloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyridin-2-amine |
| SMILES | CC1(C)CC(Nc2ccc(Cl)cn2)CC(C)(C)N1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H22ClN3.C4H4O4/c1-13(2)7-11(8-14(3,4)18-13)17-12-6-5-10(15)9-16-12;5-3(6)1-2-4(7)8/h5-6,9,11,18H,7-8H2,1-4H3,(H,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MIOFFVHDOMPGMJ-WLHGVMLRSA-N |
| XLogP | 3.17 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|