C29H26N2O2S — CID 15957773
1-(anthracen-9-ylmethyl)-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione (PubChem CID 15957773) has the molecular formula C29H26N2O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethyl)-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-(anthracen-9-ylmethyl)-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15957773 |
| Molecular Formula | C29H26N2O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 1-(anthracen-9-ylmethyl)-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1c(Sc2cc(C)cc(C)c2)n(Cc2c3ccccc3cc3ccccc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H26N2O2S/c1-4-23-27(32)30-29(33)31(28(23)34-22-14-18(2)13-19(3)15-22)17-26-24-11-7-5-9-20(24)16-21-10-6-8-12-25(21)26/h5-16H,4,17H2,1-3H3,(H,30,32,33) |
| InChIKey | WIDNBXBPIWKNRC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|