C28H35ClO8S2 — CID 159577878
ethyl 2-[(4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate;ethyl 2-[(4-sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate (PubChem CID 159577878) has the molecular formula C28H35ClO8S2 and a molecular weight of 599.17 g/mol. Its IUPAC name is ethyl 2-[(4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate;ethyl 2-[(4-sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate.
| Compound Name | ethyl 2-[(4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate;ethyl 2-[(4-sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate |
|---|---|
| PubChem CID | 159577878 |
| Molecular Formula | C28H35ClO8S2 |
| Molecular Weight | 599.17 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | ethyl 2-[(4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate;ethyl 2-[(4-sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate |
| SMILES | CCOC(=O)COc1ccc(S(=O)(=O)Cl)c2c1CCCC2.CCOC(=O)COc1ccc(S)c2c1CCCC2 |
| InChI | InChI=1S/C14H17ClO5S.C14H18O3S/c1-2-19-14(16)9-20-12-7-8-13(21(15,17)18)11-6-4-3-5-10(11)12;1-2-16-14(15)9-17-12-7-8-13(18)11-6-4-3-5-10(11)12/h7-8H,2-6,9H2,1H3;7-8,18H,2-6,9H2,1H3 |
| InChIKey | MIQGDIOGSBROSB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|