About 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium
1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium (PubChem CID 159578812) has the molecular formula C14H24F6NO4S2+
and a molecular weight of 448.47 g/mol. Its IUPAC name is 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium.
Molecular Properties
| Compound Name | 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium |
| PubChem CID | 159578812 |
| Molecular Formula | C14H24F6NO4S2+ |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium |
| SMILES | CCCC[N+]1(CCC)CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F6NO4S2/c1-3-5-9-21(8-4-2)10-6-12(7-11-21,26(22,23)13(15,16)17)27(24,25)14(18,19)20/h3-11H2,1-2H3/q+1 |
| InChIKey | JIUDDZLWFXQDHE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The IUPAC name of 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium (CID 159578812) is 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium.
What is the SMILES notation for 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The canonical SMILES for 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium is CCCC[N+]1(CCC)CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1.
What is the InChIKey of 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
The InChIKey is JIUDDZLWFXQDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F6NO4S2/c1-3-5-9-21(8-4-2)10-6-12(7-11-21,26(22,23)13(15,16)17)27(24,25)14(18,19)20/h3-11H2,1-2H3/q+1.
What are the key properties of 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium?
1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium has a molecular weight of 448.47 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-propyl-4,4-bis(trifluoromethylsulfonyl)piperidin-1-ium is sourced from PubChem (CID 159578812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).