About 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione
3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 15957883) has the molecular formula C17H20N2O3
and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione |
| PubChem CID | 15957883 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(Cn2c(=O)ccn([C@H]3CCCO3)c2=O)c1 |
| InChI | InChI=1S/C17H20N2O3/c1-12-8-13(2)10-14(9-12)11-19-15(20)5-6-18(17(19)21)16-4-3-7-22-16/h5-6,8-10,16H,3-4,7,11H2,1-2H3/t16-/m1/s1 |
| InChIKey | SQORZISMRTXUAV-MRXNPFEDSA-N |
| XLogP | 1.98 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione?
The IUPAC name of 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione (CID 15957883) is 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione.
What is the SMILES notation for 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione?
The canonical SMILES for 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione is Cc1cc(C)cc(Cn2c(=O)ccn([C@H]3CCCO3)c2=O)c1.
What is the InChIKey of 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione?
The InChIKey is SQORZISMRTXUAV-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H20N2O3/c1-12-8-13(2)10-14(9-12)11-19-15(20)5-6-18(17(19)21)16-4-3-7-22-16/h5-6,8-10,16H,3-4,7,11H2,1-2H3/t16-/m1/s1.
What are the key properties of 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione?
3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione has a molecular weight of 300.36 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylphenyl)methyl]-1-[(2R)-oxolan-2-yl]pyrimidine-2,4-dione is sourced from PubChem (CID 15957883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).