C8H10F10O — CID 159579542
fluoroethane;fluoromethane;2,2,3,3,4,5,5-heptafluoro-4-(fluoromethyl)oxolane (PubChem CID 159579542) has the molecular formula C8H10F10O and a molecular weight of 312.15 g/mol. Its IUPAC name is fluoroethane;fluoromethane;2,2,3,3,4,5,5-heptafluoro-4-(fluoromethyl)oxolane.
| Compound Name | fluoroethane;fluoromethane;2,2,3,3,4,5,5-heptafluoro-4-(fluoromethyl)oxolane |
|---|---|
| PubChem CID | 159579542 |
| Molecular Formula | C8H10F10O |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | fluoroethane;fluoromethane;2,2,3,3,4,5,5-heptafluoro-4-(fluoromethyl)oxolane |
| SMILES | CCF.CF.FCC1(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C5H2F8O.C2H5F.CH3F/c6-1-2(7)3(8,9)5(12,13)14-4(2,10)11;1-2-3;1-2/h1H2;2H2,1H3;1H3 |
| InChIKey | MIVJXCDCWYRBFK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|