About disodium;benzoate
disodium;benzoate (PubChem CID 159580825) has the molecular formula C7H4Na2O2
and a molecular weight of 166.09 g/mol. Its IUPAC name is disodium;benzoate.
Molecular Properties
| Compound Name | disodium;benzoate |
| PubChem CID | 159580825 |
| Molecular Formula | C7H4Na2O2 |
| Molecular Weight | 166.09 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | disodium;benzoate |
| SMILES | O=C([O-])c1cc[c-]cc1.[Na+].[Na+] |
| InChI | InChI=1S/C7H5O2.2Na/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);;/q-1;2*+1/p-1 |
| InChIKey | BLMODQPHBHCWFR-UHFFFAOYSA-M |
| XLogP | -6.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.09 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze disodium;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;benzoate?
The IUPAC name of disodium;benzoate (CID 159580825) is disodium;benzoate.
What is the SMILES notation for disodium;benzoate?
The canonical SMILES for disodium;benzoate is O=C([O-])c1cc[c-]cc1.[Na+].[Na+].
What is the InChIKey of disodium;benzoate?
The InChIKey is BLMODQPHBHCWFR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5O2.2Na/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);;/q-1;2*+1/p-1.
What are the key properties of disodium;benzoate?
disodium;benzoate has a molecular weight of 166.09 g/mol, XLogP of -6.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;benzoate is sourced from PubChem (CID 159580825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).