C23H35N3O5 — CID 159582103
N-(cyclopropylmethyl)-N-propyl-4-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)butan-1-amine;1-hydroperoxyperoxybut-2-yne (PubChem CID 159582103) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-propyl-4-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)butan-1-amine;1-hydroperoxyperoxybut-2-yne.
| Compound Name | N-(cyclopropylmethyl)-N-propyl-4-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)butan-1-amine;1-hydroperoxyperoxybut-2-yne |
|---|---|
| PubChem CID | 159582103 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-(cyclopropylmethyl)-N-propyl-4-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)butan-1-amine;1-hydroperoxyperoxybut-2-yne |
| SMILES | CC#CCOOOO.CCCN(CCCCOCc1cc2ccccn2n1)CC1CC1 |
| InChI | InChI=1S/C19H29N3O.C4H6O4/c1-2-10-21(15-17-8-9-17)11-5-6-13-23-16-18-14-19-7-3-4-12-22(19)20-18;1-2-3-4-6-8-7-5/h3-4,7,12,14,17H,2,5-6,8-11,13,15-16H2,1H3;5H,4H2,1H3 |
| InChIKey | MJDMBGJUXMUZHF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|