C26H38F2N2O7 — CID 159582598
ethyl (1S,4R,6S,7Z,14R,18R)-11,11-difluoro-18-hydroxy-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 159582598) has the molecular formula C26H38F2N2O7 and a molecular weight of 528.59 g/mol. Its IUPAC name is ethyl (1S,4R,6S,7Z,14R,18R)-11,11-difluoro-18-hydroxy-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,7Z,14R,18R)-11,11-difluoro-18-hydroxy-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 159582598 |
| Molecular Formula | C26H38F2N2O7 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | ethyl (1S,4R,6S,7Z,14R,18R)-11,11-difluoro-18-hydroxy-14-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCC(F)(F)CC[C@H](CC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C26H38F2N2O7/c1-5-36-23(35)26-14-17(26)8-6-7-10-25(27,28)11-9-16(12-20(32)37-24(2,3)4)22(34)30-15-18(31)13-19(30)21(33)29-26/h6,8,16-19,31H,5,7,9-15H2,1-4H3,(H,29,33)/b8-6-/t16-,17-,18-,19+,26-/m1/s1 |
| InChIKey | KKDUZWGWFUXQQI-LZVVCLJKSA-N |
| XLogP | 2.50 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|