About 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane
3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane (PubChem CID 159583476) has the molecular formula C18H30N2O8
and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane.
Molecular Properties
| Compound Name | 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane |
| PubChem CID | 159583476 |
| Molecular Formula | C18H30N2O8 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane |
| SMILES | C=C1CCCOC1=O.CC(C)(CC1CCCOC1=O)[N+](=O)[O-].CC(C)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15NO4.C6H8O2.C3H7NO2/c1-9(2,10(12)13)6-7-4-3-5-14-8(7)11;1-5-3-2-4-8-6(5)7;1-3(2)4(5)6/h7H,3-6H2,1-2H3;1-4H2;3H,1-2H3 |
| InChIKey | MJHVDXVVFPRTJQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane?
The IUPAC name of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane (CID 159583476) is 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane.
What is the SMILES notation for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane?
The canonical SMILES for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane is C=C1CCCOC1=O.CC(C)(CC1CCCOC1=O)[N+](=O)[O-].CC(C)[N+](=O)[O-].
What is the InChIKey of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane?
The InChIKey is MJHVDXVVFPRTJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4.C6H8O2.C3H7NO2/c1-9(2,10(12)13)6-7-4-3-5-14-8(7)11;1-5-3-2-4-8-6(5)7;1-3(2)4(5)6/h7H,3-6H2,1-2H3;1-4H2;3H,1-2H3.
What are the key properties of 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane?
3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane has a molecular weight of 402.44 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneoxan-2-one;3-(2-methyl-2-nitropropyl)oxan-2-one;2-nitropropane is sourced from PubChem (CID 159583476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).