C26H30O5 — CID 15958471
[(1S)-3-[2-(2,7-dioxo-1a,7a-dihydronaphtho[2,3-b]oxiren-4-yl)ethyl]-2,2-dimethyl-4-methylidenecyclohexyl] 3-methylbut-2-enoate (PubChem CID 15958471) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(1S)-3-[2-(2,7-dioxo-1a,7a-dihydronaphtho[2,3-b]oxiren-4-yl)ethyl]-2,2-dimethyl-4-methylidenecyclohexyl] 3-methylbut-2-enoate.
| Compound Name | [(1S)-3-[2-(2,7-dioxo-1a,7a-dihydronaphtho[2,3-b]oxiren-4-yl)ethyl]-2,2-dimethyl-4-methylidenecyclohexyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 15958471 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(1S)-3-[2-(2,7-dioxo-1a,7a-dihydronaphtho[2,3-b]oxiren-4-yl)ethyl]-2,2-dimethyl-4-methylidenecyclohexyl] 3-methylbut-2-enoate |
| SMILES | C=C1CC[C@H](OC(=O)C=C(C)C)C(C)(C)C1CCc1ccc2c(c1)C(=O)C1OC1C2=O |
| InChI | InChI=1S/C26H30O5/c1-14(2)12-21(27)30-20-11-6-15(3)19(26(20,4)5)10-8-16-7-9-17-18(13-16)23(29)25-24(31-25)22(17)28/h7,9,12-13,19-20,24-25H,3,6,8,10-11H2,1-2,4-5H3/t19?,20-,24?,25?/m0/s1 |
| InChIKey | BITOGWCSDFTKCY-PJZVPJHESA-N |
| XLogP | 4.64 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|