C26H37IO8 — CID 159584803
2-iodobutane;methyl 4-butan-2-yloxy-3-methoxybenzoate;methyl 4-hydroxy-3-methoxybenzoate (PubChem CID 159584803) has the molecular formula C26H37IO8 and a molecular weight of 604.48 g/mol. Its IUPAC name is 2-iodobutane;methyl 4-butan-2-yloxy-3-methoxybenzoate;methyl 4-hydroxy-3-methoxybenzoate.
| Compound Name | 2-iodobutane;methyl 4-butan-2-yloxy-3-methoxybenzoate;methyl 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 159584803 |
| Molecular Formula | C26H37IO8 |
| Molecular Weight | 604.48 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 2-iodobutane;methyl 4-butan-2-yloxy-3-methoxybenzoate;methyl 4-hydroxy-3-methoxybenzoate |
| SMILES | CCC(C)I.CCC(C)Oc1ccc(C(=O)OC)cc1OC.COC(=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C13H18O4.C9H10O4.C4H9I/c1-5-9(2)17-11-7-6-10(13(14)16-4)8-12(11)15-3;1-12-8-5-6(9(11)13-2)3-4-7(8)10;1-3-4(2)5/h6-9H,5H2,1-4H3;3-5,10H,1-2H3;4H,3H2,1-2H3 |
| InChIKey | MJMBGNNTLVZISN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|