C32H34F3N3O3 — CID 159585460
2-[6-methyl-5-(5-morpholin-4-yl-6-oct-7-ynoxy-3-pyridinyl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 159585460) has the molecular formula C32H34F3N3O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is 2-[6-methyl-5-(5-morpholin-4-yl-6-oct-7-ynoxy-3-pyridinyl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-[6-methyl-5-(5-morpholin-4-yl-6-oct-7-ynoxy-3-pyridinyl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 159585460 |
| Molecular Formula | C32H34F3N3O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-[6-methyl-5-(5-morpholin-4-yl-6-oct-7-ynoxy-3-pyridinyl)-3-pyridinyl]-1-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | C#CCCCCCCOc1ncc(-c2cc(CC(=O)c3cccc(C(F)(F)F)c3)cnc2C)cc1N1CCOCC1 |
| InChI | InChI=1S/C32H34F3N3O3/c1-3-4-5-6-7-8-14-41-31-29(38-12-15-40-16-13-38)20-26(22-37-31)28-17-24(21-36-23(28)2)18-30(39)25-10-9-11-27(19-25)32(33,34)35/h1,9-11,17,19-22H,4-8,12-16,18H2,2H3 |
| InChIKey | MJOBGJIGMDGNGG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|