C16H22N2O4S — CID 159585585
(2E,6E)-3,5-dimethoxy-7-[2-(N-methoxy-C-methylcarbonimidoyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dienal (PubChem CID 159585585) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is (2E,6E)-3,5-dimethoxy-7-[2-(N-methoxy-C-methylcarbonimidoyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dienal.
| Compound Name | (2E,6E)-3,5-dimethoxy-7-[2-(N-methoxy-C-methylcarbonimidoyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dienal |
|---|---|
| PubChem CID | 159585585 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2E,6E)-3,5-dimethoxy-7-[2-(N-methoxy-C-methylcarbonimidoyl)-1,3-thiazol-4-yl]-4-methylhepta-2,6-dienal |
| SMILES | CON=C(C)c1nc(/C=C/C(OC)C(C)/C(=C\C=O)OC)cs1 |
| InChI | InChI=1S/C16H22N2O4S/c1-11(15(21-4)8-9-19)14(20-3)7-6-13-10-23-16(17-13)12(2)18-22-5/h6-11,14H,1-5H3/b7-6+,15-8+,18-12? |
| InChIKey | WCTAJRNJKJRICW-LYJPPSSLSA-N |
| XLogP | 2.91 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|