About sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one
sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one (PubChem CID 159585944) has the molecular formula C4H9N5O4S
and a molecular weight of 223.21 g/mol. Its IUPAC name is sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one |
| PubChem CID | 159585944 |
| Molecular Formula | C4H9N5O4S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(N)c(=O)[nH]1.O=S(O)O |
| InChI | InChI=1S/C4H7N5O.H2O3S/c5-1-2(6)8-4(7)9-3(1)10;1-4(2)3/h5H2,(H5,6,7,8,9,10);(H2,1,2,3) |
| InChIKey | MJPPSGBQVVHNFA-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 181.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one?
The IUPAC name of sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one (CID 159585944) is sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one.
What is the SMILES notation for sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one?
The canonical SMILES for sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one is Nc1nc(N)c(N)c(=O)[nH]1.O=S(O)O.
What is the InChIKey of sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one?
The InChIKey is MJPPSGBQVVHNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O.H2O3S/c5-1-2(6)8-4(7)9-3(1)10;1-4(2)3/h5H2,(H5,6,7,8,9,10);(H2,1,2,3).
What are the key properties of sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one?
sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one has a molecular weight of 223.21 g/mol, XLogP of -1.80, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfurous acid;2,4,5-triamino-1H-pyrimidin-6-one is sourced from PubChem (CID 159585944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).