C23H18FN5O4 — CID 15958730
1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 15958730) has the molecular formula C23H18FN5O4 and a molecular weight of 447.43 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 15958730 |
| Molecular Formula | C23H18FN5O4 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-fluoro-7-(1,3-oxazol-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-c3ncco3)ncc(F)c12 |
| InChI | InChI=1S/C23H18FN5O4/c24-16-13-27-19(21-25-6-11-33-21)18-17(16)15(12-26-18)20(30)23(32)29-9-7-28(8-10-29)22(31)14-4-2-1-3-5-14/h1-6,11-13,26H,7-10H2 |
| InChIKey | IZRBUYMJJJICFD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|