C24H20ClN7O3 — CID 15958732
1-[7-(5-aminopyrazin-2-yl)-4-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 15958732) has the molecular formula C24H20ClN7O3 and a molecular weight of 489.92 g/mol. Its IUPAC name is 1-[7-(5-aminopyrazin-2-yl)-4-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-(5-aminopyrazin-2-yl)-4-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 15958732 |
| Molecular Formula | C24H20ClN7O3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[7-(5-aminopyrazin-2-yl)-4-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | Nc1cnc(-c2ncc(Cl)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)cn1 |
| InChI | InChI=1S/C24H20ClN7O3/c25-16-11-30-20(17-12-28-18(26)13-27-17)21-19(16)15(10-29-21)22(33)24(35)32-8-6-31(7-9-32)23(34)14-4-2-1-3-5-14/h1-5,10-13,29H,6-9H2,(H2,26,28) |
| InChIKey | HNANGQUCGRAOIK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|