C25H23N7O3 — CID 15958739
1-[7-(5-aminopyrazin-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]ethane-1,2-dione (PubChem CID 15958739) has the molecular formula C25H23N7O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is 1-[7-(5-aminopyrazin-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[7-(5-aminopyrazin-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 15958739 |
| Molecular Formula | C25H23N7O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[7-(5-aminopyrazin-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(-c3cnc(N)cn3)nccc12 |
| InChI | InChI=1S/C25H23N7O3/c1-15-14-31(24(34)16-5-3-2-4-6-16)9-10-32(15)25(35)23(33)18-11-30-21-17(18)7-8-27-22(21)19-12-29-20(26)13-28-19/h2-8,11-13,15,30H,9-10,14H2,1H3,(H2,26,29)/t15-/m1/s1 |
| InChIKey | QXLYFSORJKGZKX-OAHLLOKOSA-N |
| XLogP | 2.16 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|