C24H24FN5O3 — CID 15958794
1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyrrolidin-1-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione (PubChem CID 15958794) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyrrolidin-1-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyrrolidin-1-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 15958794 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-pyrrolidin-1-yl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(N3CCCC3)ncc(F)c12 |
| InChI | InChI=1S/C24H24FN5O3/c25-18-15-27-22(28-8-4-5-9-28)20-19(18)17(14-26-20)21(31)24(33)30-12-10-29(11-13-30)23(32)16-6-2-1-3-7-16/h1-3,6-7,14-15,26H,4-5,8-13H2 |
| InChIKey | RQOXSVZLQZRAGE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|