C23H20FN7O3 — CID 15958839
1-[7-(3-aminopyrazol-1-yl)-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 15958839) has the molecular formula C23H20FN7O3 and a molecular weight of 461.46 g/mol. Its IUPAC name is 1-[7-(3-aminopyrazol-1-yl)-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-[7-(3-aminopyrazol-1-yl)-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 15958839 |
| Molecular Formula | C23H20FN7O3 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[7-(3-aminopyrazol-1-yl)-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-(4-benzoylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | Nc1ccn(-c2ncc(F)c3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)CC4)c[nH]c23)n1 |
| InChI | InChI=1S/C23H20FN7O3/c24-16-13-27-21(31-7-6-17(25)28-31)19-18(16)15(12-26-19)20(32)23(34)30-10-8-29(9-11-30)22(33)14-4-2-1-3-5-14/h1-7,12-13,26H,8-11H2,(H2,25,28) |
| InChIKey | GCZUYHMLYFVJHN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|