C23H21N7O3 — CID 15958913
1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(triazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 15958913) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(triazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(triazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 15958913 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(triazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)C(=O)c2c[nH]c3c(-n4nccn4)ccnc23)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21N7O3/c1-15-14-28(11-12-29(15)22(32)16-5-3-2-4-6-16)23(33)21(31)17-13-25-20-18(7-8-24-19(17)20)30-26-9-10-27-30/h2-10,13,15,25H,11-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | LKULNNBUWWEKRR-OAHLLOKOSA-N |
| XLogP | 1.70 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|