C24H21N5O4 — CID 15958920
1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(1,3-oxazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 15958920) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(1,3-oxazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(1,3-oxazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 15958920 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-[(3R)-4-benzoyl-3-methylpiperazin-1-yl]-2-[7-(1,3-oxazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)C(=O)c2c[nH]c3c(-c4ncco4)ccnc23)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O4/c1-15-14-28(10-11-29(15)23(31)16-5-3-2-4-6-16)24(32)21(30)18-13-27-19-17(7-8-25-20(18)19)22-26-9-12-33-22/h2-9,12-13,15,27H,10-11,14H2,1H3/t15-/m1/s1 |
| InChIKey | JRWYJVICDAOUJV-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|