About 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide
5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide (PubChem CID 15958965) has the molecular formula C18H18ClN2O3P
and a molecular weight of 376.78 g/mol. Its IUPAC name is 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
| PubChem CID | 15958965 |
| Molecular Formula | C18H18ClN2O3P |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1ccc(C)c(C)c1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H18ClN2O3P/c1-10-4-6-13(8-11(10)2)25(23,24-3)17-14-9-12(19)5-7-15(14)21-16(17)18(20)22/h4-9,21H,1-3H3,(H2,20,22) |
| InChIKey | ITEUVHRIQDJUMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide?
The IUPAC name of 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide (CID 15958965) is 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide.
What is the SMILES notation for 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide?
The canonical SMILES for 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide is COP(=O)(c1ccc(C)c(C)c1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12.
What is the InChIKey of 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide?
The InChIKey is ITEUVHRIQDJUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN2O3P/c1-10-4-6-13(8-11(10)2)25(23,24-3)17-14-9-12(19)5-7-15(14)21-16(17)18(20)22/h4-9,21H,1-3H3,(H2,20,22).
What are the key properties of 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide?
5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide has a molecular weight of 376.78 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(3,4-dimethylphenyl)-methoxyphosphoryl]-1H-indole-2-carboxamide is sourced from PubChem (CID 15958965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).