C12H3F10N3O4 — CID 159589832
3-(6-fluoro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 159589832) has the molecular formula C12H3F10N3O4 and a molecular weight of 443.15 g/mol. Its IUPAC name is 3-(6-fluoro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 3-(6-fluoro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 159589832 |
| Molecular Formula | C12H3F10N3O4 |
| Molecular Weight | 443.15 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 3-(6-fluoro-3-pyridinyl)-5-(trifluoromethyl)-1,2,4-oxadiazole;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | Fc1ccc(-c2noc(C(F)(F)F)n2)cn1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H3F4N3O.C4F6O3/c9-5-2-1-4(3-13-5)6-14-7(16-15-6)8(10,11)12;5-3(6,7)1(11)13-2(12)4(8,9)10/h1-3H; |
| InChIKey | MKCDFNQZFAELJQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|