C10H9F14NO — CID 159590185
1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N-methyl-N-(trifluoromethyl)propan-1-amine (PubChem CID 159590185) has the molecular formula C10H9F14NO and a molecular weight of 425.16 g/mol. Its IUPAC name is 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N-methyl-N-(trifluoromethyl)propan-1-amine.
| Compound Name | 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N-methyl-N-(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 159590185 |
| Molecular Formula | C10H9F14NO |
| Molecular Weight | 425.16 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)-N-methyl-N-(trifluoromethyl)propan-1-amine |
| SMILES | CN(C(F)C(F)(COCC(F)(F)C(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F14NO/c1-25(10(22,23)24)5(12)6(13,9(19,20)21)2-26-3-7(14,15)4(11)8(16,17)18/h4-5H,2-3H2,1H3 |
| InChIKey | QZFSNESUZKSNPH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|