About 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one
2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one (PubChem CID 15959116) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one |
| PubChem CID | 15959116 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one |
| SMILES | COc1cc(Cc2nn(C)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O4/c1-21-19(22)14-8-6-5-7-13(14)15(20-21)9-12-10-16(23-2)18(25-4)17(11-12)24-3/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | VQXNHOPNBXIUCU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one?
The IUPAC name of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one (CID 15959116) is 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one.
What is the SMILES notation for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one?
The canonical SMILES for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one is COc1cc(Cc2nn(C)c(=O)c3ccccc23)cc(OC)c1OC.
What is the InChIKey of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one?
The InChIKey is VQXNHOPNBXIUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-21-19(22)14-8-6-5-7-13(14)15(20-21)9-12-10-16(23-2)18(25-4)17(11-12)24-3/h5-8,10-11H,9H2,1-4H3.
What are the key properties of 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one?
2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one has a molecular weight of 340.38 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(3,4,5-trimethoxyphenyl)methyl]phthalazin-1-one is sourced from PubChem (CID 15959116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).