About 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide
3-methylidenepyrrolidine-2,5-dione;prop-2-enamide (PubChem CID 159591311) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide.
Molecular Properties
| Compound Name | 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide |
| PubChem CID | 159591311 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide |
| SMILES | C=C1CC(=O)NC1=O.C=CC(N)=O |
| InChI | InChI=1S/C5H5NO2.C3H5NO/c1-3-2-4(7)6-5(3)8;1-2-3(4)5/h1-2H2,(H,6,7,8);2H,1H2,(H2,4,5) |
| InChIKey | MKGVJHNIQQNNDC-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide?
The IUPAC name of 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide (CID 159591311) is 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide.
What is the SMILES notation for 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide?
The canonical SMILES for 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide is C=C1CC(=O)NC1=O.C=CC(N)=O.
What is the InChIKey of 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide?
The InChIKey is MKGVJHNIQQNNDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.C3H5NO/c1-3-2-4(7)6-5(3)8;1-2-3(4)5/h1-2H2,(H,6,7,8);2H,1H2,(H2,4,5).
What are the key properties of 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide?
3-methylidenepyrrolidine-2,5-dione;prop-2-enamide has a molecular weight of 182.18 g/mol, XLogP of -0.75, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenepyrrolidine-2,5-dione;prop-2-enamide is sourced from PubChem (CID 159591311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).