About benzotriazol-1-yl 1H-indole-2-carboxylate
benzotriazol-1-yl 1H-indole-2-carboxylate (PubChem CID 15959241) has the molecular formula C15H10N4O2
and a molecular weight of 278.27 g/mol. Its IUPAC name is benzotriazol-1-yl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | benzotriazol-1-yl 1H-indole-2-carboxylate |
| PubChem CID | 15959241 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | benzotriazol-1-yl 1H-indole-2-carboxylate |
| SMILES | O=C(On1nnc2ccccc21)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H10N4O2/c20-15(13-9-10-5-1-2-6-11(10)16-13)21-19-14-8-4-3-7-12(14)17-18-19/h1-9,16H |
| InChIKey | ZDPADJJUIZEJSZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl 1H-indole-2-carboxylate?
The IUPAC name of benzotriazol-1-yl 1H-indole-2-carboxylate (CID 15959241) is benzotriazol-1-yl 1H-indole-2-carboxylate.
What is the SMILES notation for benzotriazol-1-yl 1H-indole-2-carboxylate?
The canonical SMILES for benzotriazol-1-yl 1H-indole-2-carboxylate is O=C(On1nnc2ccccc21)c1cc2ccccc2[nH]1.
What is the InChIKey of benzotriazol-1-yl 1H-indole-2-carboxylate?
The InChIKey is ZDPADJJUIZEJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O2/c20-15(13-9-10-5-1-2-6-11(10)16-13)21-19-14-8-4-3-7-12(14)17-18-19/h1-9,16H.
What are the key properties of benzotriazol-1-yl 1H-indole-2-carboxylate?
benzotriazol-1-yl 1H-indole-2-carboxylate has a molecular weight of 278.27 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl 1H-indole-2-carboxylate is sourced from PubChem (CID 15959241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).