C16H29N3O5 — CID 159592888
(3R,4R)-4-(diaminomethylideneamino)-2-[(2S,3R)-1,2-dihydroxy-5,5-dimethylhexan-3-yl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 159592888) has the molecular formula C16H29N3O5 and a molecular weight of 343.42 g/mol. Its IUPAC name is (3R,4R)-4-(diaminomethylideneamino)-2-[(2S,3R)-1,2-dihydroxy-5,5-dimethylhexan-3-yl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R,4R)-4-(diaminomethylideneamino)-2-[(2S,3R)-1,2-dihydroxy-5,5-dimethylhexan-3-yl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 159592888 |
| Molecular Formula | C16H29N3O5 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (3R,4R)-4-(diaminomethylideneamino)-2-[(2S,3R)-1,2-dihydroxy-5,5-dimethylhexan-3-yl]-3-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C[C@H]1C([C@H](CC(C)(C)C)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C16H29N3O5/c1-8-10(19-15(17)18)5-12(14(22)23)24-13(8)9(11(21)7-20)6-16(2,3)4/h5,8-11,13,20-21H,6-7H2,1-4H3,(H,22,23)(H4,17,18,19)/t8-,9-,10+,11-,13?/m1/s1 |
| InChIKey | MKLSEMZHCUGIPD-TWEVDUBQSA-N |
| XLogP | 0.04 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|