C37H36N2O4 — CID 15959302
ethyl (E,4S)-5-phenyl-4-[[(2S)-3-phenyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoyl]amino]pent-2-enoate (PubChem CID 15959302) has the molecular formula C37H36N2O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is ethyl (E,4S)-5-phenyl-4-[[(2S)-3-phenyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoyl]amino]pent-2-enoate.
| Compound Name | ethyl (E,4S)-5-phenyl-4-[[(2S)-3-phenyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 15959302 |
| Molecular Formula | C37H36N2O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | ethyl (E,4S)-5-phenyl-4-[[(2S)-3-phenyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]propanoyl]amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H36N2O4/c1-2-43-36(41)25-23-33(26-29-12-6-3-7-13-29)38-37(42)34(27-30-14-8-4-9-15-30)39-35(40)24-20-28-18-21-32(22-19-28)31-16-10-5-11-17-31/h3-25,33-34H,2,26-27H2,1H3,(H,38,42)(H,39,40)/b24-20+,25-23+/t33-,34+/m1/s1 |
| InChIKey | PQFVYUJGFLSMKA-PFKUUMJMSA-N |
| XLogP | 5.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|