C31H31N3O6 — CID 15959303
ethyl (E,4S)-4-[[(2S)-2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate (PubChem CID 15959303) has the molecular formula C31H31N3O6 and a molecular weight of 541.60 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 15959303 |
| Molecular Formula | C31H31N3O6 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H31N3O6/c1-2-40-30(36)20-16-26(21-24-9-5-3-6-10-24)32-31(37)28(22-25-11-7-4-8-12-25)33-29(35)19-15-23-13-17-27(18-14-23)34(38)39/h3-20,26,28H,2,21-22H2,1H3,(H,32,37)(H,33,35)/b19-15+,20-16+/t26-,28+/m1/s1 |
| InChIKey | XAYRYKDJTCRRDA-FGOHTXDJSA-N |
| XLogP | 4.18 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|