C30H36N2O6 — CID 15959307
ethyl (E,4S)-4-[[4-[[(E,2R)-5-ethoxy-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-oxobutanoyl]amino]-5-phenylpent-2-enoate (PubChem CID 15959307) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[4-[[(E,2R)-5-ethoxy-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-oxobutanoyl]amino]-5-phenylpent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[4-[[(E,2R)-5-ethoxy-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-oxobutanoyl]amino]-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 15959307 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | ethyl (E,4S)-4-[[4-[[(E,2R)-5-ethoxy-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-oxobutanoyl]amino]-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)CCC(=O)N[C@@H](/C=C/C(=O)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C30H36N2O6/c1-3-37-29(35)19-15-25(21-23-11-7-5-8-12-23)31-27(33)17-18-28(34)32-26(16-20-30(36)38-4-2)22-24-13-9-6-10-14-24/h5-16,19-20,25-26H,3-4,17-18,21-22H2,1-2H3,(H,31,33)(H,32,34)/b19-15+,20-16+/t25-,26+ |
| InChIKey | NDSWYVYFYYLXLX-LVKSPMBZSA-N |
| XLogP | 3.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|