C27H31NO3 — CID 159593151
1-[(1'R,11'S)-1'-ethylspiro[1,3-dioxolane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-yl]-2-(2-methyl-3-pyridinyl)ethanone (PubChem CID 159593151) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[(1'R,11'S)-1'-ethylspiro[1,3-dioxolane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-yl]-2-(2-methyl-3-pyridinyl)ethanone.
| Compound Name | 1-[(1'R,11'S)-1'-ethylspiro[1,3-dioxolane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-yl]-2-(2-methyl-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 159593151 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-[(1'R,11'S)-1'-ethylspiro[1,3-dioxolane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-yl]-2-(2-methyl-3-pyridinyl)ethanone |
| SMILES | CC[C@@]12CCC3(C[C@@H]1CC=Cc1cc(C(=O)Cc4cccnc4C)ccc12)OCCO3 |
| InChI | InChI=1S/C27H31NO3/c1-3-26-11-12-27(30-14-15-31-27)18-23(26)8-4-6-21-16-22(9-10-24(21)26)25(29)17-20-7-5-13-28-19(20)2/h4-7,9-10,13,16,23H,3,8,11-12,14-15,17-18H2,1-2H3/t23-,26+/m0/s1 |
| InChIKey | YOLZSUZDRWBDPG-JYFHCDHNSA-N |
| XLogP | 5.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |