C10H10F6N6O2 — CID 159593503
4-nitro-1-(2,2,2-trifluoroethyl)pyrazole;1-(2,2,2-trifluoroethyl)pyrazol-4-amine (PubChem CID 159593503) has the molecular formula C10H10F6N6O2 and a molecular weight of 360.22 g/mol. Its IUPAC name is 4-nitro-1-(2,2,2-trifluoroethyl)pyrazole;1-(2,2,2-trifluoroethyl)pyrazol-4-amine.
| Compound Name | 4-nitro-1-(2,2,2-trifluoroethyl)pyrazole;1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 159593503 |
| Molecular Formula | C10H10F6N6O2 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-nitro-1-(2,2,2-trifluoroethyl)pyrazole;1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
| SMILES | Nc1cnn(CC(F)(F)F)c1.O=[N+]([O-])c1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C5H4F3N3O2.C5H6F3N3/c6-5(7,8)3-10-2-4(1-9-10)11(12)13;6-5(7,8)3-11-2-4(9)1-10-11/h1-2H,3H2;1-2H,3,9H2 |
| InChIKey | MKNOCPFDGCCVAH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|