C24H28O6 — CID 159593706
ethyl 3-oxo-4-phenylbutanoate;2-ethyl-3-oxo-4-phenylbutanoic acid (PubChem CID 159593706) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is ethyl 3-oxo-4-phenylbutanoate;2-ethyl-3-oxo-4-phenylbutanoic acid.
| Compound Name | ethyl 3-oxo-4-phenylbutanoate;2-ethyl-3-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 159593706 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethyl 3-oxo-4-phenylbutanoate;2-ethyl-3-oxo-4-phenylbutanoic acid |
| SMILES | CCC(C(=O)O)C(=O)Cc1ccccc1.CCOC(=O)CC(=O)Cc1ccccc1 |
| InChI | InChI=1S/2C12H14O3/c1-2-15-12(14)9-11(13)8-10-6-4-3-5-7-10;1-2-10(12(14)15)11(13)8-9-6-4-3-5-7-9/h3-7H,2,8-9H2,1H3;3-7,10H,2,8H2,1H3,(H,14,15) |
| InChIKey | MKODQTXHIIOHFU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|