About diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid
diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid (PubChem CID 159593997) has the molecular formula C12H24N2O7P2S
and a molecular weight of 402.35 g/mol. Its IUPAC name is diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid.
Molecular Properties
| Compound Name | diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid |
| PubChem CID | 159593997 |
| Molecular Formula | C12H24N2O7P2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid |
| SMILES | CCOP(=S)(OCC)Oc1cc(C)nc(C(C)C)n1.O=P(O)(O)O |
| InChI | InChI=1S/C12H21N2O3PS.H3O4P/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4;1-5(2,3)4/h8-9H,6-7H2,1-5H3;(H3,1,2,3,4) |
| InChIKey | MKPFJJYFQUMOKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 131.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid?
The IUPAC name of diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid (CID 159593997) is diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid.
What is the SMILES notation for diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid?
The canonical SMILES for diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid is CCOP(=S)(OCC)Oc1cc(C)nc(C(C)C)n1.O=P(O)(O)O.
What is the InChIKey of diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid?
The InChIKey is MKPFJJYFQUMOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N2O3PS.H3O4P/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4;1-5(2,3)4/h8-9H,6-7H2,1-5H3;(H3,1,2,3,4).
What are the key properties of diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid?
diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid has a molecular weight of 402.35 g/mol, XLogP of 2.66, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxy-sulfanylidene-λ5-phosphane;phosphoric acid is sourced from PubChem (CID 159593997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).