About bis(5-bromo-1H-indazole);methane
bis(5-bromo-1H-indazole);methane (PubChem CID 159594803) has the molecular formula C15H14Br2N4
and a molecular weight of 410.11 g/mol. Its IUPAC name is bis(5-bromo-1H-indazole);methane.
Molecular Properties
| Compound Name | bis(5-bromo-1H-indazole);methane |
| PubChem CID | 159594803 |
| Molecular Formula | C15H14Br2N4 |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | bis(5-bromo-1H-indazole);methane |
| SMILES | Brc1ccc2[nH]ncc2c1.Brc1ccc2[nH]ncc2c1.C |
| InChI | InChI=1S/2C7H5BrN2.CH4/c2*8-6-1-2-7-5(3-6)4-9-10-7;/h2*1-4H,(H,9,10);1H4 |
| InChIKey | MKRVMEHWCUURAE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(5-bromo-1H-indazole);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-bromo-1H-indazole);methane?
The IUPAC name of bis(5-bromo-1H-indazole);methane (CID 159594803) is bis(5-bromo-1H-indazole);methane.
What is the SMILES notation for bis(5-bromo-1H-indazole);methane?
The canonical SMILES for bis(5-bromo-1H-indazole);methane is Brc1ccc2[nH]ncc2c1.Brc1ccc2[nH]ncc2c1.C.
What is the InChIKey of bis(5-bromo-1H-indazole);methane?
The InChIKey is MKRVMEHWCUURAE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5BrN2.CH4/c2*8-6-1-2-7-5(3-6)4-9-10-7;/h2*1-4H,(H,9,10);1H4.
What are the key properties of bis(5-bromo-1H-indazole);methane?
bis(5-bromo-1H-indazole);methane has a molecular weight of 410.11 g/mol, XLogP of 5.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-bromo-1H-indazole);methane is sourced from PubChem (CID 159594803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).