C17H20OS — CID 15959535
9-(cyclopenten-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide (PubChem CID 15959535) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is 9-(cyclopenten-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide.
| Compound Name | 9-(cyclopenten-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide |
|---|---|
| PubChem CID | 15959535 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 9-(cyclopenten-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide |
| SMILES | O=S1C=C2C=C3CCCCC3C(C3=CCCC3)C2=C1 |
| InChI | InChI=1S/C17H20OS/c18-19-10-14-9-13-7-3-4-8-15(13)17(16(14)11-19)12-5-1-2-6-12/h5,9-11,15,17H,1-4,6-8H2 |
| InChIKey | LSGGOTRKDIEPOY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|