C22H44NO3P — CID 159596103
1-[[(2R,3S,4S,5S)-2-(deuteriomethyl)-4,5-dimethyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]nonan-2-one (PubChem CID 159596103) has the molecular formula C22H44NO3P and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-[[(2R,3S,4S,5S)-2-(deuteriomethyl)-4,5-dimethyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]nonan-2-one.
| Compound Name | 1-[[(2R,3S,4S,5S)-2-(deuteriomethyl)-4,5-dimethyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]nonan-2-one |
|---|---|
| PubChem CID | 159596103 |
| Molecular Formula | C22H44NO3P |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 1-[[(2R,3S,4S,5S)-2-(deuteriomethyl)-4,5-dimethyloxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]nonan-2-one |
| SMILES | [2H]C[C@H]1O[C@@H](C)[C@H](C)[C@@H]1OP(CC(=O)CCCCCCC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44NO3P/c1-9-10-11-12-13-14-21(24)15-27(23(16(2)3)17(4)5)26-22-18(6)19(7)25-20(22)8/h16-20,22H,9-15H2,1-8H3/t18-,19-,20+,22-,27?/m0/s1/i8D |
| InChIKey | RJXPLHQQFMRCMQ-XURLONDOSA-N |
| XLogP | 6.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|