C19H21F3N2O6S — CID 159597082
(4-carbamoyl-2,6-dimethylphenyl) trifluoromethanesulfonate;4-hydroxy-3,5-dimethylbenzamide (PubChem CID 159597082) has the molecular formula C19H21F3N2O6S and a molecular weight of 462.45 g/mol. Its IUPAC name is (4-carbamoyl-2,6-dimethylphenyl) trifluoromethanesulfonate;4-hydroxy-3,5-dimethylbenzamide.
| Compound Name | (4-carbamoyl-2,6-dimethylphenyl) trifluoromethanesulfonate;4-hydroxy-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 159597082 |
| Molecular Formula | C19H21F3N2O6S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (4-carbamoyl-2,6-dimethylphenyl) trifluoromethanesulfonate;4-hydroxy-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(C)c1O.Cc1cc(C(N)=O)cc(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4S.C9H11NO2/c1-5-3-7(9(14)15)4-6(2)8(5)18-19(16,17)10(11,12)13;1-5-3-7(9(10)12)4-6(2)8(5)11/h3-4H,1-2H3,(H2,14,15);3-4,11H,1-2H3,(H2,10,12) |
| InChIKey | MKZJLFPSPYDRRA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|