C22H26ClF2NO2 — CID 159598706
5-[3-[3-(3-chlorophenyl)propoxy]phenyl]-5,5-difluoro-N,N-dimethylpentanamide (PubChem CID 159598706) has the molecular formula C22H26ClF2NO2 and a molecular weight of 409.90 g/mol. Its IUPAC name is 5-[3-[3-(3-chlorophenyl)propoxy]phenyl]-5,5-difluoro-N,N-dimethylpentanamide.
| Compound Name | 5-[3-[3-(3-chlorophenyl)propoxy]phenyl]-5,5-difluoro-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 159598706 |
| Molecular Formula | C22H26ClF2NO2 |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 5-[3-[3-(3-chlorophenyl)propoxy]phenyl]-5,5-difluoro-N,N-dimethylpentanamide |
| SMILES | CN(C)C(=O)CCCC(F)(F)c1cccc(OCCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H26ClF2NO2/c1-26(2)21(27)12-5-13-22(24,25)18-9-4-11-20(16-18)28-14-6-8-17-7-3-10-19(23)15-17/h3-4,7,9-11,15-16H,5-6,8,12-14H2,1-2H3 |
| InChIKey | MLEJRQAXMRLTOG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|