C18H26N2O3 — CID 159598822
(3S)-6-[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;methane (PubChem CID 159598822) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3S)-6-[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;methane.
| Compound Name | (3S)-6-[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;methane |
|---|---|
| PubChem CID | 159598822 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3S)-6-[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;methane |
| SMILES | C.C[C@H]1Cc2cc([C@@H]3CN4CCNC[C@@H]4CO3)ccc2C(=O)O1 |
| InChI | InChI=1S/C17H22N2O3.CH4/c1-11-6-13-7-12(2-3-15(13)17(20)22-11)16-9-19-5-4-18-8-14(19)10-21-16;/h2-3,7,11,14,16,18H,4-6,8-10H2,1H3;1H4/t11-,14+,16-;/m0./s1 |
| InChIKey | MLESPXRNCRGKAG-OBMSPZSFSA-N |
| XLogP | 1.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |