C43H25F10O2+ — CID 15959908
2-(2,3,4,5,6-pentafluorophenyl)-8-[(E)-[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene]methyl]-4-phenyl-6,7-dihydro-5H-chromene (PubChem CID 15959908) has the molecular formula C43H25F10O2+ and a molecular weight of 763.65 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-8-[(E)-[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene]methyl]-4-phenyl-6,7-dihydro-5H-chromene.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-8-[(E)-[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene]methyl]-4-phenyl-6,7-dihydro-5H-chromene |
|---|---|
| PubChem CID | 15959908 |
| Molecular Formula | C43H25F10O2+ |
| Molecular Weight | 763.65 g/mol |
| Exact Mass | 763.17 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-8-[(E)-[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-1-ium-8-ylidene]methyl]-4-phenyl-6,7-dihydro-5H-chromene |
| SMILES | Fc1c(F)c(F)c(C2=CC(c3ccccc3)=C3CCCC(/C=C4\CCCc5c(-c6ccccc6)cc(-c6c(F)c(F)c(F)c(F)c6F)[o+]c54)=C3O2)c(F)c1F |
| InChI | InChI=1S/C43H25F10O2/c44-32-30(33(45)37(49)40(52)36(32)48)28-18-26(20-9-3-1-4-10-20)24-15-7-13-22(42(24)54-28)17-23-14-8-16-25-27(21-11-5-2-6-12-21)19-29(55-43(23)25)31-34(46)38(50)41(53)39(51)35(31)47/h1-6,9-12,17-19H,7-8,13-16H2/q+1 |
| InChIKey | XNMFSHNHPJDZAH-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.65 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|