About 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine
2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine (PubChem CID 159600283) has the molecular formula C12H18N6O4
and a molecular weight of 310.31 g/mol. Its IUPAC name is 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine |
| PubChem CID | 159600283 |
| Molecular Formula | C12H18N6O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine |
| SMILES | COc1cc(N)nc(OC)n1.COc1ncc(OC)c(N)n1 |
| InChI | InChI=1S/2C6H9N3O2/c1-10-4-3-8-6(11-2)9-5(4)7;1-10-5-3-4(7)8-6(9-5)11-2/h2*3H,1-2H3,(H2,7,8,9) |
| InChIKey | MLJTYKFFDNQTHQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine?
The IUPAC name of 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine (CID 159600283) is 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine.
What is the SMILES notation for 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine?
The canonical SMILES for 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine is COc1cc(N)nc(OC)n1.COc1ncc(OC)c(N)n1.
What is the InChIKey of 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine?
The InChIKey is MLJTYKFFDNQTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9N3O2/c1-10-4-3-8-6(11-2)9-5(4)7;1-10-5-3-4(7)8-6(9-5)11-2/h2*3H,1-2H3,(H2,7,8,9).
What are the key properties of 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine?
2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine has a molecular weight of 310.31 g/mol, XLogP of 0.15, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxypyrimidin-4-amine;2,6-dimethoxypyrimidin-4-amine is sourced from PubChem (CID 159600283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).