C34H38N4O5 — CID 159602047
N-hydroxy-5-[5-[3-[(1S,2R,4R)-4-(2-methoxyethyl)-2-phenylcyclopentyl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-1-methyl-2-oxopyridine-3-carboxamide (PubChem CID 159602047) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is N-hydroxy-5-[5-[3-[(1S,2R,4R)-4-(2-methoxyethyl)-2-phenylcyclopentyl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-1-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-hydroxy-5-[5-[3-[(1S,2R,4R)-4-(2-methoxyethyl)-2-phenylcyclopentyl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-1-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 159602047 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | N-hydroxy-5-[5-[3-[(1S,2R,4R)-4-(2-methoxyethyl)-2-phenylcyclopentyl]-2-oxopropyl]-4-methyl-1-phenylpyrazol-3-yl]-1-methyl-2-oxopyridine-3-carboxamide |
| SMILES | COCC[C@@H]1C[C@@H](CC(=O)Cc2c(C)c(-c3cc(C(=O)NO)c(=O)n(C)c3)nn2-c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C34H38N4O5/c1-22-31(20-28(39)18-25-16-23(14-15-43-3)17-29(25)24-10-6-4-7-11-24)38(27-12-8-5-9-13-27)35-32(22)26-19-30(33(40)36-42)34(41)37(2)21-26/h4-13,19,21,23,25,29,42H,14-18,20H2,1-3H3,(H,36,40)/t23-,25+,29+/m1/s1 |
| InChIKey | MLPHKKSWRSTJBD-APJNYFBKSA-N |
| XLogP | 5.01 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|