C19H18ClNOS — CID 159602122
8-chloro-3-(2-hydroxypropan-2-yl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione (PubChem CID 159602122) has the molecular formula C19H18ClNOS and a molecular weight of 343.88 g/mol. Its IUPAC name is 8-chloro-3-(2-hydroxypropan-2-yl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione.
| Compound Name | 8-chloro-3-(2-hydroxypropan-2-yl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione |
|---|---|
| PubChem CID | 159602122 |
| Molecular Formula | C19H18ClNOS |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 8-chloro-3-(2-hydroxypropan-2-yl)-1-phenyl-3,5-dihydro-2-benzazepine-4-thione |
| SMILES | CC(C)(O)C1N=C(c2ccccc2)c2cc(Cl)ccc2CC1=S |
| InChI | InChI=1S/C19H18ClNOS/c1-19(2,22)18-16(23)10-13-8-9-14(20)11-15(13)17(21-18)12-6-4-3-5-7-12/h3-9,11,18,22H,10H2,1-2H3 |
| InChIKey | MLPNXLRXCQEWJI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|