C31H56B2N2O8 — CID 159602214
tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine-2-carboxylate;methane;2-[2-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethylboronic acid (PubChem CID 159602214) has the molecular formula C31H56B2N2O8 and a molecular weight of 606.42 g/mol. Its IUPAC name is tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine-2-carboxylate;methane;2-[2-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethylboronic acid.
| Compound Name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine-2-carboxylate;methane;2-[2-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethylboronic acid |
|---|---|
| PubChem CID | 159602214 |
| Molecular Formula | C31H56B2N2O8 |
| Molecular Weight | 606.42 g/mol |
| Exact Mass | 606.42 |
| IUPAC Name | tert-butyl 4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine-2-carboxylate;methane;2-[2-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]ethylboronic acid |
| SMILES | C.CC(C)(C)OC(=O)C1CC(CCB(O)O)CCN1.CC(C)(C)OC(=O)c1cc(CCB2OC(C)(C)C(C)(C)O2)ccn1 |
| InChI | InChI=1S/C18H28BNO4.C12H24BNO4.CH4/c1-16(2,3)22-15(21)14-12-13(9-11-20-14)8-10-19-23-17(4,5)18(6,7)24-19;1-12(2,3)18-11(15)10-8-9(5-7-14-10)4-6-13(16)17;/h9,11-12H,8,10H2,1-7H3;9-10,14,16-17H,4-8H2,1-3H3;1H4 |
| InChIKey | MLPWUZUCWFERFK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|